C32H42BrN5O4 — CID 155128324
tert-butyl N-[4-[8-bromo-2-butyl-4-(2,4-dimethoxy-N-methylanilino)imidazo[4,5-c]quinolin-1-yl]butyl]carbamate (PubChem CID 155128324) has the molecular formula C32H42BrN5O4 and a molecular weight of 640.62 g/mol. Its IUPAC name is tert-butyl N-[4-[8-bromo-2-butyl-4-(2,4-dimethoxy-N-methylanilino)imidazo[4,5-c]quinolin-1-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[8-bromo-2-butyl-4-(2,4-dimethoxy-N-methylanilino)imidazo[4,5-c]quinolin-1-yl]butyl]carbamate |
|---|---|
| PubChem CID | 155128324 |
| Molecular Formula | C32H42BrN5O4 |
| Molecular Weight | 640.62 g/mol |
| Exact Mass | 639.24 |
| IUPAC Name | tert-butyl N-[4-[8-bromo-2-butyl-4-(2,4-dimethoxy-N-methylanilino)imidazo[4,5-c]quinolin-1-yl]butyl]carbamate |
| SMILES | CCCCc1nc2c(N(C)c3ccc(OC)cc3OC)nc3ccc(Br)cc3c2n1CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H42BrN5O4/c1-8-9-12-27-36-28-29(38(27)18-11-10-17-34-31(39)42-32(2,3)4)23-19-21(33)13-15-24(23)35-30(28)37(5)25-16-14-22(40-6)20-26(25)41-7/h13-16,19-20H,8-12,17-18H2,1-7H3,(H,34,39) |
| InChIKey | KECCCSDVPZIIIC-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.62 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|