C18H15FN4O2 — CID 155128548
(15S)-10-ethenyl-21-fluoro-13,17-dioxa-3,5,7,8-tetrazapentacyclo[13.6.1.04,12.05,9.018,22]docosa-1(21),4(12),6,8,10,18(22),19-heptaene (PubChem CID 155128548) has the molecular formula C18H15FN4O2 and a molecular weight of 338.34 g/mol. Its IUPAC name is (15S)-10-ethenyl-21-fluoro-13,17-dioxa-3,5,7,8-tetrazapentacyclo[13.6.1.04,12.05,9.018,22]docosa-1(21),4(12),6,8,10,18(22),19-heptaene.
| Compound Name | (15S)-10-ethenyl-21-fluoro-13,17-dioxa-3,5,7,8-tetrazapentacyclo[13.6.1.04,12.05,9.018,22]docosa-1(21),4(12),6,8,10,18(22),19-heptaene |
|---|---|
| PubChem CID | 155128548 |
| Molecular Formula | C18H15FN4O2 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (15S)-10-ethenyl-21-fluoro-13,17-dioxa-3,5,7,8-tetrazapentacyclo[13.6.1.04,12.05,9.018,22]docosa-1(21),4(12),6,8,10,18(22),19-heptaene |
| SMILES | C=Cc1cc2c(n3cnnc13)NCc1c(F)ccc3c1[C@@H](CO3)CO2 |
| InChI | InChI=1S/C18H15FN4O2/c1-2-10-5-15-18(23-9-21-22-17(10)23)20-6-12-13(19)3-4-14-16(12)11(7-24-14)8-25-15/h2-5,9,11,20H,1,6-8H2/t11-/m0/s1 |
| InChIKey | KSGMJUSRESTBFY-NSHDSACASA-N |
| XLogP | 2.99 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |