About [(2R,4S)-4-amino-2-ethenylcyclopentyl]methanol
[(2R,4S)-4-amino-2-ethenylcyclopentyl]methanol (PubChem CID 155129113) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is [(2R,4S)-4-amino-2-ethenylcyclopentyl]methanol.
Molecular Properties
| Compound Name | [(2R,4S)-4-amino-2-ethenylcyclopentyl]methanol |
| PubChem CID | 155129113 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | [(2R,4S)-4-amino-2-ethenylcyclopentyl]methanol |
| SMILES | C=C[C@H]1C[C@H](N)CC1CO |
| InChI | InChI=1S/C8H15NO/c1-2-6-3-8(9)4-7(6)5-10/h2,6-8,10H,1,3-5,9H2/t6-,7?,8-/m0/s1 |
| InChIKey | CLBHVEGNEGEEDU-PPSBICQBSA-N |
| XLogP | 0.52 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2R,4S)-4-amino-2-ethenylcyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,4S)-4-amino-2-ethenylcyclopentyl]methanol?
The IUPAC name of [(2R,4S)-4-amino-2-ethenylcyclopentyl]methanol (CID 155129113) is [(2R,4S)-4-amino-2-ethenylcyclopentyl]methanol.
What is the SMILES notation for [(2R,4S)-4-amino-2-ethenylcyclopentyl]methanol?
The canonical SMILES for [(2R,4S)-4-amino-2-ethenylcyclopentyl]methanol is C=C[C@H]1C[C@H](N)CC1CO.
What is the InChIKey of [(2R,4S)-4-amino-2-ethenylcyclopentyl]methanol?
The InChIKey is CLBHVEGNEGEEDU-PPSBICQBSA-N. The full InChI is InChI=1S/C8H15NO/c1-2-6-3-8(9)4-7(6)5-10/h2,6-8,10H,1,3-5,9H2/t6-,7?,8-/m0/s1.
What are the key properties of [(2R,4S)-4-amino-2-ethenylcyclopentyl]methanol?
[(2R,4S)-4-amino-2-ethenylcyclopentyl]methanol has a molecular weight of 141.21 g/mol, XLogP of 0.52, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,4S)-4-amino-2-ethenylcyclopentyl]methanol is sourced from PubChem (CID 155129113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).