About (7E)-7,8-dimethyl-4-methylimino-3-sulfanylidenetrideca-7,11-dien-2-one
(7E)-7,8-dimethyl-4-methylimino-3-sulfanylidenetrideca-7,11-dien-2-one (PubChem CID 155129130) has the molecular formula C16H25NOS
and a molecular weight of 279.45 g/mol. Its IUPAC name is (7E)-7,8-dimethyl-4-methylimino-3-sulfanylidenetrideca-7,11-dien-2-one.
Molecular Properties
| Compound Name | (7E)-7,8-dimethyl-4-methylimino-3-sulfanylidenetrideca-7,11-dien-2-one |
| PubChem CID | 155129130 |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | (7E)-7,8-dimethyl-4-methylimino-3-sulfanylidenetrideca-7,11-dien-2-one |
| SMILES | CC=CCC/C(C)=C(\C)CC/C(=N\C)C(=S)C(C)=O |
| InChI | InChI=1S/C16H25NOS/c1-6-7-8-9-12(2)13(3)10-11-15(17-5)16(19)14(4)18/h6-7H,8-11H2,1-5H3/b7-6?,13-12+,17-15+ |
| InChIKey | SAICDHORLIMIQY-UNJAWSEBSA-N |
| XLogP | 4.49 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (7E)-7,8-dimethyl-4-methylimino-3-sulfanylidenetrideca-7,11-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7E)-7,8-dimethyl-4-methylimino-3-sulfanylidenetrideca-7,11-dien-2-one?
The IUPAC name of (7E)-7,8-dimethyl-4-methylimino-3-sulfanylidenetrideca-7,11-dien-2-one (CID 155129130) is (7E)-7,8-dimethyl-4-methylimino-3-sulfanylidenetrideca-7,11-dien-2-one.
What is the SMILES notation for (7E)-7,8-dimethyl-4-methylimino-3-sulfanylidenetrideca-7,11-dien-2-one?
The canonical SMILES for (7E)-7,8-dimethyl-4-methylimino-3-sulfanylidenetrideca-7,11-dien-2-one is CC=CCC/C(C)=C(\C)CC/C(=N\C)C(=S)C(C)=O.
What is the InChIKey of (7E)-7,8-dimethyl-4-methylimino-3-sulfanylidenetrideca-7,11-dien-2-one?
The InChIKey is SAICDHORLIMIQY-UNJAWSEBSA-N. The full InChI is InChI=1S/C16H25NOS/c1-6-7-8-9-12(2)13(3)10-11-15(17-5)16(19)14(4)18/h6-7H,8-11H2,1-5H3/b7-6?,13-12+,17-15+.
What are the key properties of (7E)-7,8-dimethyl-4-methylimino-3-sulfanylidenetrideca-7,11-dien-2-one?
(7E)-7,8-dimethyl-4-methylimino-3-sulfanylidenetrideca-7,11-dien-2-one has a molecular weight of 279.45 g/mol, XLogP of 4.49, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7E)-7,8-dimethyl-4-methylimino-3-sulfanylidenetrideca-7,11-dien-2-one is sourced from PubChem (CID 155129130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).