C27H36N2O8 — CID 155129300
(5R,13aS)-13-(dimethylamino)-1,12-dihydroxy-5-(hydroxymethyl)-3,4,9,11-tetramethoxy-2,10-dimethyl-8,13,13a,14-tetrahydro-5H-isoquinolino[3,2-b][3]benzazepin-7-one (PubChem CID 155129300) has the molecular formula C27H36N2O8 and a molecular weight of 516.59 g/mol. Its IUPAC name is (5R,13aS)-13-(dimethylamino)-1,12-dihydroxy-5-(hydroxymethyl)-3,4,9,11-tetramethoxy-2,10-dimethyl-8,13,13a,14-tetrahydro-5H-isoquinolino[3,2-b][3]benzazepin-7-one.
| Compound Name | (5R,13aS)-13-(dimethylamino)-1,12-dihydroxy-5-(hydroxymethyl)-3,4,9,11-tetramethoxy-2,10-dimethyl-8,13,13a,14-tetrahydro-5H-isoquinolino[3,2-b][3]benzazepin-7-one |
|---|---|
| PubChem CID | 155129300 |
| Molecular Formula | C27H36N2O8 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | (5R,13aS)-13-(dimethylamino)-1,12-dihydroxy-5-(hydroxymethyl)-3,4,9,11-tetramethoxy-2,10-dimethyl-8,13,13a,14-tetrahydro-5H-isoquinolino[3,2-b][3]benzazepin-7-one |
| SMILES | COc1c(C)c(OC)c2c(c1O)C(N(C)C)[C@@H]1Cc3c(O)c(C)c(OC)c(OC)c3[C@H](CO)N1C(=O)C2 |
| InChI | InChI=1S/C27H36N2O8/c1-12-22(32)14-9-16-21(28(3)4)20-15(24(34-5)13(2)25(35-6)23(20)33)10-18(31)29(16)17(11-30)19(14)27(37-8)26(12)36-7/h16-17,21,30,32-33H,9-11H2,1-8H3/t16-,17-,21?/m0/s1 |
| InChIKey | LPLVKLJQFULOKI-MVWJYJSVSA-N |
| XLogP | 2.39 |
| TPSA | 121.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|