C12H21N3O — CID 155129800
3-[[[(3E)-hexa-3,5-dien-3-yl]amino]methylideneamino]-N,2-dimethylpropanamide (PubChem CID 155129800) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 3-[[[(3E)-hexa-3,5-dien-3-yl]amino]methylideneamino]-N,2-dimethylpropanamide.
| Compound Name | 3-[[[(3E)-hexa-3,5-dien-3-yl]amino]methylideneamino]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 155129800 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 3-[[[(3E)-hexa-3,5-dien-3-yl]amino]methylideneamino]-N,2-dimethylpropanamide |
| SMILES | C=C/C=C(\CC)N/C=N/CC(C)C(=O)NC |
| InChI | InChI=1S/C12H21N3O/c1-5-7-11(6-2)15-9-14-8-10(3)12(16)13-4/h5,7,9-10H,1,6,8H2,2-4H3,(H,13,16)(H,14,15)/b11-7+ |
| InChIKey | WPGLNJJNNKCQGE-YRNVUSSQSA-N |
| XLogP | 1.47 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|