C14H25N3O — CID 155129821
3-[ethyl-[[(3E)-hexa-3,5-dien-3-yl]iminomethyl]amino]-N,2-dimethylpropanamide (PubChem CID 155129821) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 3-[ethyl-[[(3E)-hexa-3,5-dien-3-yl]iminomethyl]amino]-N,2-dimethylpropanamide.
| Compound Name | 3-[ethyl-[[(3E)-hexa-3,5-dien-3-yl]iminomethyl]amino]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 155129821 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 3-[ethyl-[[(3E)-hexa-3,5-dien-3-yl]iminomethyl]amino]-N,2-dimethylpropanamide |
| SMILES | C=C/C=C(CC)/N=C/N(CC)CC(C)C(=O)NC |
| InChI | InChI=1S/C14H25N3O/c1-6-9-13(7-2)16-11-17(8-3)10-12(4)14(18)15-5/h6,9,11-12H,1,7-8,10H2,2-5H3,(H,15,18)/b13-9+,16-11+ |
| InChIKey | NAVQDBYTJUIWSJ-XBLSULRXSA-N |
| XLogP | 2.20 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|