C16H31N3 — CID 155129977
(1E,7E)-4-ethenyl-6-ethyl-2-[methyl(methylamino)amino]deca-1,7-dien-1-amine (PubChem CID 155129977) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is (1E,7E)-4-ethenyl-6-ethyl-2-[methyl(methylamino)amino]deca-1,7-dien-1-amine.
| Compound Name | (1E,7E)-4-ethenyl-6-ethyl-2-[methyl(methylamino)amino]deca-1,7-dien-1-amine |
|---|---|
| PubChem CID | 155129977 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | (1E,7E)-4-ethenyl-6-ethyl-2-[methyl(methylamino)amino]deca-1,7-dien-1-amine |
| SMILES | C=CC(C/C(=C\N)N(C)NC)CC(/C=C/CC)CC |
| InChI | InChI=1S/C16H31N3/c1-6-9-10-14(7-2)11-15(8-3)12-16(13-17)19(5)18-4/h8-10,13-15,18H,3,6-7,11-12,17H2,1-2,4-5H3/b10-9+,16-13+ |
| InChIKey | MINORQSJUDBTHZ-FVTBZGPOSA-N |
| XLogP | 3.43 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|