C33H33N3 — CID 155130112
3-[5-(2,2-dimethylpropyl)cyclohepta-1,4,6-trien-1-yl]-4-phenyl-5-(4-phenylcyclohepta-1,3,6-trien-1-yl)-1,2,4-triazole (PubChem CID 155130112) has the molecular formula C33H33N3 and a molecular weight of 471.65 g/mol. Its IUPAC name is 3-[5-(2,2-dimethylpropyl)cyclohepta-1,4,6-trien-1-yl]-4-phenyl-5-(4-phenylcyclohepta-1,3,6-trien-1-yl)-1,2,4-triazole.
| Compound Name | 3-[5-(2,2-dimethylpropyl)cyclohepta-1,4,6-trien-1-yl]-4-phenyl-5-(4-phenylcyclohepta-1,3,6-trien-1-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 155130112 |
| Molecular Formula | C33H33N3 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | 3-[5-(2,2-dimethylpropyl)cyclohepta-1,4,6-trien-1-yl]-4-phenyl-5-(4-phenylcyclohepta-1,3,6-trien-1-yl)-1,2,4-triazole |
| SMILES | CC(C)(C)CC1=CCC=C(c2nnc(C3=CC=C(c4ccccc4)CC=C3)n2-c2ccccc2)C=C1 |
| InChI | InChI=1S/C33H33N3/c1-33(2,3)24-25-12-10-16-28(21-20-25)31-34-35-32(36(31)30-18-8-5-9-19-30)29-17-11-15-27(22-23-29)26-13-6-4-7-14-26/h4-9,11-14,16-23H,10,15,24H2,1-3H3 |
| InChIKey | ZCFAXWCNVXAXHS-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |