C43H77NO — CID 155130233
2,3-bis[(8Z,11Z)-heptadeca-8,11-dienyl]-8-methyl-1-oxa-8-azaspiro[4.5]decane (PubChem CID 155130233) has the molecular formula C43H77NO and a molecular weight of 624.09 g/mol. Its IUPAC name is 2,3-bis[(8Z,11Z)-heptadeca-8,11-dienyl]-8-methyl-1-oxa-8-azaspiro[4.5]decane.
| Compound Name | 2,3-bis[(8Z,11Z)-heptadeca-8,11-dienyl]-8-methyl-1-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 155130233 |
| Molecular Formula | C43H77NO |
| Molecular Weight | 624.09 g/mol |
| Exact Mass | 623.60 |
| IUPAC Name | 2,3-bis[(8Z,11Z)-heptadeca-8,11-dienyl]-8-methyl-1-oxa-8-azaspiro[4.5]decane |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC1CC2(CCN(C)CC2)OC1CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C43H77NO/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-41-40-43(36-38-44(3)39-37-43)45-42(41)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,41-42H,4-11,16-17,22-40H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | ANSNLSBJXJKIPG-QYCRHRGJSA-N |
| XLogP | 13.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.09 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|