C20H28O3S — CID 155130373
(2R,4R)-2-[[(2S,3S,4R)-4-methoxy-3-(phenylsulfanylmethyl)oxolan-2-yl]methyl]-4-methyl-3-methylideneoxane (PubChem CID 155130373) has the molecular formula C20H28O3S and a molecular weight of 348.51 g/mol. Its IUPAC name is (2R,4R)-2-[[(2S,3S,4R)-4-methoxy-3-(phenylsulfanylmethyl)oxolan-2-yl]methyl]-4-methyl-3-methylideneoxane.
| Compound Name | (2R,4R)-2-[[(2S,3S,4R)-4-methoxy-3-(phenylsulfanylmethyl)oxolan-2-yl]methyl]-4-methyl-3-methylideneoxane |
|---|---|
| PubChem CID | 155130373 |
| Molecular Formula | C20H28O3S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (2R,4R)-2-[[(2S,3S,4R)-4-methoxy-3-(phenylsulfanylmethyl)oxolan-2-yl]methyl]-4-methyl-3-methylideneoxane |
| SMILES | C=C1[C@H](C)CCO[C@@H]1C[C@@H]1OC[C@H](OC)[C@H]1CSc1ccccc1 |
| InChI | InChI=1S/C20H28O3S/c1-14-9-10-22-18(15(14)2)11-19-17(20(21-3)12-23-19)13-24-16-7-5-4-6-8-16/h4-8,14,17-20H,2,9-13H2,1,3H3/t14-,17+,18-,19+,20+/m1/s1 |
| InChIKey | YZVIAZSAJNGORU-CKMGUBGDSA-N |
| XLogP | 4.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|