About N-[amino-[amino(ethyl)amino]methylidene]-2,2,2-trifluoro-N'-methylethanimidamide
N-[amino-[amino(ethyl)amino]methylidene]-2,2,2-trifluoro-N'-methylethanimidamide (PubChem CID 155130415) has the molecular formula C6H12F3N5
and a molecular weight of 211.19 g/mol. Its IUPAC name is N-[amino-[amino(ethyl)amino]methylidene]-2,2,2-trifluoro-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-[amino-[amino(ethyl)amino]methylidene]-2,2,2-trifluoro-N'-methylethanimidamide |
| PubChem CID | 155130415 |
| Molecular Formula | C6H12F3N5 |
| Molecular Weight | 211.19 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | N-[amino-[amino(ethyl)amino]methylidene]-2,2,2-trifluoro-N'-methylethanimidamide |
| SMILES | CCN(N)/C(N)=N/C(=N/C)C(F)(F)F |
| InChI | InChI=1S/C6H12F3N5/c1-3-14(11)5(10)13-4(12-2)6(7,8)9/h3,11H2,1-2H3,(H2,10,12,13) |
| InChIKey | KBWDWIPPJHAIGJ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.19 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[amino-[amino(ethyl)amino]methylidene]-2,2,2-trifluoro-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[amino-[amino(ethyl)amino]methylidene]-2,2,2-trifluoro-N'-methylethanimidamide?
The IUPAC name of N-[amino-[amino(ethyl)amino]methylidene]-2,2,2-trifluoro-N'-methylethanimidamide (CID 155130415) is N-[amino-[amino(ethyl)amino]methylidene]-2,2,2-trifluoro-N'-methylethanimidamide.
What is the SMILES notation for N-[amino-[amino(ethyl)amino]methylidene]-2,2,2-trifluoro-N'-methylethanimidamide?
The canonical SMILES for N-[amino-[amino(ethyl)amino]methylidene]-2,2,2-trifluoro-N'-methylethanimidamide is CCN(N)/C(N)=N/C(=N/C)C(F)(F)F.
What is the InChIKey of N-[amino-[amino(ethyl)amino]methylidene]-2,2,2-trifluoro-N'-methylethanimidamide?
The InChIKey is KBWDWIPPJHAIGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12F3N5/c1-3-14(11)5(10)13-4(12-2)6(7,8)9/h3,11H2,1-2H3,(H2,10,12,13).
What are the key properties of N-[amino-[amino(ethyl)amino]methylidene]-2,2,2-trifluoro-N'-methylethanimidamide?
N-[amino-[amino(ethyl)amino]methylidene]-2,2,2-trifluoro-N'-methylethanimidamide has a molecular weight of 211.19 g/mol, XLogP of 0.09, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[amino-[amino(ethyl)amino]methylidene]-2,2,2-trifluoro-N'-methylethanimidamide is sourced from PubChem (CID 155130415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).