About 2-[amino-(2-methyl-1,3-dihydrotetrazol-5-yl)amino]-N,N-dimethylethanamine
2-[amino-(2-methyl-1,3-dihydrotetrazol-5-yl)amino]-N,N-dimethylethanamine (PubChem CID 155130424) has the molecular formula C6H17N7
and a molecular weight of 187.25 g/mol. Its IUPAC name is 2-[amino-(2-methyl-1,3-dihydrotetrazol-5-yl)amino]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[amino-(2-methyl-1,3-dihydrotetrazol-5-yl)amino]-N,N-dimethylethanamine |
| PubChem CID | 155130424 |
| Molecular Formula | C6H17N7 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.15 |
| IUPAC Name | 2-[amino-(2-methyl-1,3-dihydrotetrazol-5-yl)amino]-N,N-dimethylethanamine |
| SMILES | CN(C)CCN(N)C1=NNN(C)N1 |
| InChI | InChI=1S/C6H17N7/c1-11(2)4-5-13(7)6-8-10-12(3)9-6/h10H,4-5,7H2,1-3H3,(H,8,9) |
| InChIKey | SUDFMHZXGHVKCZ-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[amino-(2-methyl-1,3-dihydrotetrazol-5-yl)amino]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[amino-(2-methyl-1,3-dihydrotetrazol-5-yl)amino]-N,N-dimethylethanamine?
The IUPAC name of 2-[amino-(2-methyl-1,3-dihydrotetrazol-5-yl)amino]-N,N-dimethylethanamine (CID 155130424) is 2-[amino-(2-methyl-1,3-dihydrotetrazol-5-yl)amino]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[amino-(2-methyl-1,3-dihydrotetrazol-5-yl)amino]-N,N-dimethylethanamine?
The canonical SMILES for 2-[amino-(2-methyl-1,3-dihydrotetrazol-5-yl)amino]-N,N-dimethylethanamine is CN(C)CCN(N)C1=NNN(C)N1.
What is the InChIKey of 2-[amino-(2-methyl-1,3-dihydrotetrazol-5-yl)amino]-N,N-dimethylethanamine?
The InChIKey is SUDFMHZXGHVKCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H17N7/c1-11(2)4-5-13(7)6-8-10-12(3)9-6/h10H,4-5,7H2,1-3H3,(H,8,9).
What are the key properties of 2-[amino-(2-methyl-1,3-dihydrotetrazol-5-yl)amino]-N,N-dimethylethanamine?
2-[amino-(2-methyl-1,3-dihydrotetrazol-5-yl)amino]-N,N-dimethylethanamine has a molecular weight of 187.25 g/mol, XLogP of -2.05, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[amino-(2-methyl-1,3-dihydrotetrazol-5-yl)amino]-N,N-dimethylethanamine is sourced from PubChem (CID 155130424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).