About 1-(2,3-dihydro-1H-tetrazol-5-yl)-1-propylhydrazine
1-(2,3-dihydro-1H-tetrazol-5-yl)-1-propylhydrazine (PubChem CID 155130432) has the molecular formula C4H12N6
and a molecular weight of 144.18 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-tetrazol-5-yl)-1-propylhydrazine.
Molecular Properties
| Compound Name | 1-(2,3-dihydro-1H-tetrazol-5-yl)-1-propylhydrazine |
| PubChem CID | 155130432 |
| Molecular Formula | C4H12N6 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.11 |
| IUPAC Name | 1-(2,3-dihydro-1H-tetrazol-5-yl)-1-propylhydrazine |
| SMILES | CCCN(N)C1=NNNN1 |
| InChI | InChI=1S/C4H12N6/c1-2-3-10(5)4-6-8-9-7-4/h8-9H,2-3,5H2,1H3,(H,6,7) |
| InChIKey | HLGABJGSHITKGO-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3-dihydro-1H-tetrazol-5-yl)-1-propylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydro-1H-tetrazol-5-yl)-1-propylhydrazine?
The IUPAC name of 1-(2,3-dihydro-1H-tetrazol-5-yl)-1-propylhydrazine (CID 155130432) is 1-(2,3-dihydro-1H-tetrazol-5-yl)-1-propylhydrazine.
What is the SMILES notation for 1-(2,3-dihydro-1H-tetrazol-5-yl)-1-propylhydrazine?
The canonical SMILES for 1-(2,3-dihydro-1H-tetrazol-5-yl)-1-propylhydrazine is CCCN(N)C1=NNNN1.
What is the InChIKey of 1-(2,3-dihydro-1H-tetrazol-5-yl)-1-propylhydrazine?
The InChIKey is HLGABJGSHITKGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N6/c1-2-3-10(5)4-6-8-9-7-4/h8-9H,2-3,5H2,1H3,(H,6,7).
What are the key properties of 1-(2,3-dihydro-1H-tetrazol-5-yl)-1-propylhydrazine?
1-(2,3-dihydro-1H-tetrazol-5-yl)-1-propylhydrazine has a molecular weight of 144.18 g/mol, XLogP of -1.54, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydro-1H-tetrazol-5-yl)-1-propylhydrazine is sourced from PubChem (CID 155130432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).