About 1-prop-2-enyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine
1-prop-2-enyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine (PubChem CID 155130452) has the molecular formula C6H8F3N5
and a molecular weight of 207.16 g/mol. Its IUPAC name is 1-prop-2-enyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine.
Molecular Properties
| Compound Name | 1-prop-2-enyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine |
| PubChem CID | 155130452 |
| Molecular Formula | C6H8F3N5 |
| Molecular Weight | 207.16 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 1-prop-2-enyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine |
| SMILES | C=CCN(N)c1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C6H8F3N5/c1-2-3-14(10)5-11-4(12-13-5)6(7,8)9/h2H,1,3,10H2,(H,11,12,13) |
| InChIKey | OHHXUXABOGSRST-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.16 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-enyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-enyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine?
The IUPAC name of 1-prop-2-enyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine (CID 155130452) is 1-prop-2-enyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine.
What is the SMILES notation for 1-prop-2-enyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine?
The canonical SMILES for 1-prop-2-enyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine is C=CCN(N)c1n[nH]c(C(F)(F)F)n1.
What is the InChIKey of 1-prop-2-enyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine?
The InChIKey is OHHXUXABOGSRST-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F3N5/c1-2-3-14(10)5-11-4(12-13-5)6(7,8)9/h2H,1,3,10H2,(H,11,12,13).
What are the key properties of 1-prop-2-enyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine?
1-prop-2-enyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine has a molecular weight of 207.16 g/mol, XLogP of 0.69, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hydrazine is sourced from PubChem (CID 155130452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).