C3H10N5P — CID 155130472
1-(3,4-dihydro-2H-1,2,4,3-triazaphosphol-5-yl)-1-ethylhydrazine (PubChem CID 155130472) has the molecular formula C3H10N5P and a molecular weight of 147.12 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,2,4,3-triazaphosphol-5-yl)-1-ethylhydrazine.
| Compound Name | 1-(3,4-dihydro-2H-1,2,4,3-triazaphosphol-5-yl)-1-ethylhydrazine |
|---|---|
| PubChem CID | 155130472 |
| Molecular Formula | C3H10N5P |
| Molecular Weight | 147.12 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,2,4,3-triazaphosphol-5-yl)-1-ethylhydrazine |
| SMILES | CCN(N)C1=NNPN1 |
| InChI | InChI=1S/C3H10N5P/c1-2-8(4)3-5-7-9-6-3/h7,9H,2,4H2,1H3,(H,5,6) |
| InChIKey | NACPKWXJXHESMP-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.12 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|