C14H18N2O — CID 155131154
3-[2-(4-methoxyphenyl)ethyl]-1,4-dimethylpyrazole (PubChem CID 155131154) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenyl)ethyl]-1,4-dimethylpyrazole.
| Compound Name | 3-[2-(4-methoxyphenyl)ethyl]-1,4-dimethylpyrazole |
|---|---|
| PubChem CID | 155131154 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 3-[2-(4-methoxyphenyl)ethyl]-1,4-dimethylpyrazole |
| SMILES | COc1ccc(CCc2nn(C)cc2C)cc1 |
| InChI | InChI=1S/C14H18N2O/c1-11-10-16(2)15-14(11)9-6-12-4-7-13(17-3)8-5-12/h4-5,7-8,10H,6,9H2,1-3H3 |
| InChIKey | LUBAEWQSTRTATC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |