About (2S)-2,4-dimethyl-2-prop-2-enylmorpholin-3-one
(2S)-2,4-dimethyl-2-prop-2-enylmorpholin-3-one (PubChem CID 155131475) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is (2S)-2,4-dimethyl-2-prop-2-enylmorpholin-3-one.
Molecular Properties
| Compound Name | (2S)-2,4-dimethyl-2-prop-2-enylmorpholin-3-one |
| PubChem CID | 155131475 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (2S)-2,4-dimethyl-2-prop-2-enylmorpholin-3-one |
| SMILES | C=CC[C@]1(C)OCCN(C)C1=O |
| InChI | InChI=1S/C9H15NO2/c1-4-5-9(2)8(11)10(3)6-7-12-9/h4H,1,5-7H2,2-3H3/t9-/m0/s1 |
| InChIKey | WKXUXXSSSGNLFD-VIFPVBQESA-N |
| XLogP | 0.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,4-dimethyl-2-prop-2-enylmorpholin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,4-dimethyl-2-prop-2-enylmorpholin-3-one?
The IUPAC name of (2S)-2,4-dimethyl-2-prop-2-enylmorpholin-3-one (CID 155131475) is (2S)-2,4-dimethyl-2-prop-2-enylmorpholin-3-one.
What is the SMILES notation for (2S)-2,4-dimethyl-2-prop-2-enylmorpholin-3-one?
The canonical SMILES for (2S)-2,4-dimethyl-2-prop-2-enylmorpholin-3-one is C=CC[C@]1(C)OCCN(C)C1=O.
What is the InChIKey of (2S)-2,4-dimethyl-2-prop-2-enylmorpholin-3-one?
The InChIKey is WKXUXXSSSGNLFD-VIFPVBQESA-N. The full InChI is InChI=1S/C9H15NO2/c1-4-5-9(2)8(11)10(3)6-7-12-9/h4H,1,5-7H2,2-3H3/t9-/m0/s1.
What are the key properties of (2S)-2,4-dimethyl-2-prop-2-enylmorpholin-3-one?
(2S)-2,4-dimethyl-2-prop-2-enylmorpholin-3-one has a molecular weight of 169.22 g/mol, XLogP of 0.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,4-dimethyl-2-prop-2-enylmorpholin-3-one is sourced from PubChem (CID 155131475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).