C28H28N4O — CID 155131802
(10S,14R,15R)-4-(2-cyclobutyl-6-methoxy-3-pyridinyl)-15-phenyl-1,8,12-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraene (PubChem CID 155131802) has the molecular formula C28H28N4O and a molecular weight of 436.56 g/mol. Its IUPAC name is (10S,14R,15R)-4-(2-cyclobutyl-6-methoxy-3-pyridinyl)-15-phenyl-1,8,12-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraene.
| Compound Name | (10S,14R,15R)-4-(2-cyclobutyl-6-methoxy-3-pyridinyl)-15-phenyl-1,8,12-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraene |
|---|---|
| PubChem CID | 155131802 |
| Molecular Formula | C28H28N4O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | (10S,14R,15R)-4-(2-cyclobutyl-6-methoxy-3-pyridinyl)-15-phenyl-1,8,12-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraene |
| SMILES | COc1ccc(-c2ccc3nc4n(c3c2)[C@@H](c2ccccc2)[C@H]2CNC[C@@H]42)c(C2CCC2)n1 |
| InChI | InChI=1S/C28H28N4O/c1-33-25-13-11-20(26(31-25)17-8-5-9-17)19-10-12-23-24(14-19)32-27(18-6-3-2-4-7-18)21-15-29-16-22(21)28(32)30-23/h2-4,6-7,10-14,17,21-22,27,29H,5,8-9,15-16H2,1H3/t21-,22+,27-/m0/s1 |
| InChIKey | ASGBCTSTOZWNKR-XXAUWVGASA-N |
| XLogP | 5.28 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |