C26H31N7O3 — CID 155131956
(12Z)-5-[4-[2-(dimethylamino)ethoxy]anilino]-16-hydroxy-2,4,6,10,21-pentazatetracyclo[15.3.1.02,10.03,8]henicosa-1(20),4,7,12,17(21),18-hexaen-9-one (PubChem CID 155131956) has the molecular formula C26H31N7O3 and a molecular weight of 489.58 g/mol. Its IUPAC name is (12Z)-5-[4-[2-(dimethylamino)ethoxy]anilino]-16-hydroxy-2,4,6,10,21-pentazatetracyclo[15.3.1.02,10.03,8]henicosa-1(20),4,7,12,17(21),18-hexaen-9-one.
| Compound Name | (12Z)-5-[4-[2-(dimethylamino)ethoxy]anilino]-16-hydroxy-2,4,6,10,21-pentazatetracyclo[15.3.1.02,10.03,8]henicosa-1(20),4,7,12,17(21),18-hexaen-9-one |
|---|---|
| PubChem CID | 155131956 |
| Molecular Formula | C26H31N7O3 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | (12Z)-5-[4-[2-(dimethylamino)ethoxy]anilino]-16-hydroxy-2,4,6,10,21-pentazatetracyclo[15.3.1.02,10.03,8]henicosa-1(20),4,7,12,17(21),18-hexaen-9-one |
| SMILES | CN(C)CCOc1ccc(NC2=NC3C(=CN2)C(=O)N2C/C=C\CCC(O)c4cccc(n4)N32)cc1 |
| InChI | InChI=1S/C26H31N7O3/c1-31(2)15-16-36-19-12-10-18(11-13-19)28-26-27-17-20-24(30-26)33-23-9-6-7-21(29-23)22(34)8-4-3-5-14-32(33)25(20)35/h3,5-7,9-13,17,22,24,34H,4,8,14-16H2,1-2H3,(H2,27,28,30)/b5-3- |
| InChIKey | YCPBFWFJOMJRLP-HYXAFXHYSA-N |
| XLogP | 2.25 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|