C18H19N5O2S — CID 155132062
(12Z)-16-hydroxy-16-methyl-5-methylsulfanyl-2,4,6,10,21-pentazatetracyclo[15.3.1.02,10.03,8]henicosa-1(20),3,5,7,12,17(21),18-heptaen-9-one (PubChem CID 155132062) has the molecular formula C18H19N5O2S and a molecular weight of 369.45 g/mol. Its IUPAC name is (12Z)-16-hydroxy-16-methyl-5-methylsulfanyl-2,4,6,10,21-pentazatetracyclo[15.3.1.02,10.03,8]henicosa-1(20),3,5,7,12,17(21),18-heptaen-9-one.
| Compound Name | (12Z)-16-hydroxy-16-methyl-5-methylsulfanyl-2,4,6,10,21-pentazatetracyclo[15.3.1.02,10.03,8]henicosa-1(20),3,5,7,12,17(21),18-heptaen-9-one |
|---|---|
| PubChem CID | 155132062 |
| Molecular Formula | C18H19N5O2S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | (12Z)-16-hydroxy-16-methyl-5-methylsulfanyl-2,4,6,10,21-pentazatetracyclo[15.3.1.02,10.03,8]henicosa-1(20),3,5,7,12,17(21),18-heptaen-9-one |
| SMILES | CSc1ncc2c(=O)n3n(c2n1)-c1cccc(n1)C(C)(O)CC/C=C\C3 |
| InChI | InChI=1S/C18H19N5O2S/c1-18(25)9-4-3-5-10-22-16(24)12-11-19-17(26-2)21-15(12)23(22)14-8-6-7-13(18)20-14/h3,5-8,11,25H,4,9-10H2,1-2H3/b5-3- |
| InChIKey | SOIGLHINANMEAJ-HYXAFXHYSA-N |
| XLogP | 2.26 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|