About 6-methyl-1H-pyrrolo[2,3-a]phenanthridin-6-ium
6-methyl-1H-pyrrolo[2,3-a]phenanthridin-6-ium (PubChem CID 15513210) has the molecular formula C16H13N2+
and a molecular weight of 233.29 g/mol. Its IUPAC name is 6-methyl-1H-pyrrolo[2,3-a]phenanthridin-6-ium.
Molecular Properties
| Compound Name | 6-methyl-1H-pyrrolo[2,3-a]phenanthridin-6-ium |
| PubChem CID | 15513210 |
| Molecular Formula | C16H13N2+ |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 6-methyl-1H-pyrrolo[2,3-a]phenanthridin-6-ium |
| SMILES | C[n+]1cc2ccccc2c2c3[nH]ccc3ccc21 |
| InChI | InChI=1S/C16H12N2/c1-18-10-12-4-2-3-5-13(12)15-14(18)7-6-11-8-9-17-16(11)15/h2-10H,1H3/p+1 |
| InChIKey | KHGIIEUPAJRKNF-UHFFFAOYSA-O |
| XLogP | 3.30 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-1H-pyrrolo[2,3-a]phenanthridin-6-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1H-pyrrolo[2,3-a]phenanthridin-6-ium?
The IUPAC name of 6-methyl-1H-pyrrolo[2,3-a]phenanthridin-6-ium (CID 15513210) is 6-methyl-1H-pyrrolo[2,3-a]phenanthridin-6-ium.
What is the SMILES notation for 6-methyl-1H-pyrrolo[2,3-a]phenanthridin-6-ium?
The canonical SMILES for 6-methyl-1H-pyrrolo[2,3-a]phenanthridin-6-ium is C[n+]1cc2ccccc2c2c3[nH]ccc3ccc21.
What is the InChIKey of 6-methyl-1H-pyrrolo[2,3-a]phenanthridin-6-ium?
The InChIKey is KHGIIEUPAJRKNF-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H12N2/c1-18-10-12-4-2-3-5-13(12)15-14(18)7-6-11-8-9-17-16(11)15/h2-10H,1H3/p+1.
What are the key properties of 6-methyl-1H-pyrrolo[2,3-a]phenanthridin-6-ium?
6-methyl-1H-pyrrolo[2,3-a]phenanthridin-6-ium has a molecular weight of 233.29 g/mol, XLogP of 3.30, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1H-pyrrolo[2,3-a]phenanthridin-6-ium is sourced from PubChem (CID 15513210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).