About 1-(4-methyl-3,4-dihydropyridin-6-yl)ethane-1,2-diamine
1-(4-methyl-3,4-dihydropyridin-6-yl)ethane-1,2-diamine (PubChem CID 155132108) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 1-(4-methyl-3,4-dihydropyridin-6-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-(4-methyl-3,4-dihydropyridin-6-yl)ethane-1,2-diamine |
| PubChem CID | 155132108 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 1-(4-methyl-3,4-dihydropyridin-6-yl)ethane-1,2-diamine |
| SMILES | CC1C=C(C(N)CN)N=CC1 |
| InChI | InChI=1S/C8H15N3/c1-6-2-3-11-8(4-6)7(10)5-9/h3-4,6-7H,2,5,9-10H2,1H3 |
| InChIKey | IVILWORUTHEFQO-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-methyl-3,4-dihydropyridin-6-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methyl-3,4-dihydropyridin-6-yl)ethane-1,2-diamine?
The IUPAC name of 1-(4-methyl-3,4-dihydropyridin-6-yl)ethane-1,2-diamine (CID 155132108) is 1-(4-methyl-3,4-dihydropyridin-6-yl)ethane-1,2-diamine.
What is the SMILES notation for 1-(4-methyl-3,4-dihydropyridin-6-yl)ethane-1,2-diamine?
The canonical SMILES for 1-(4-methyl-3,4-dihydropyridin-6-yl)ethane-1,2-diamine is CC1C=C(C(N)CN)N=CC1.
What is the InChIKey of 1-(4-methyl-3,4-dihydropyridin-6-yl)ethane-1,2-diamine?
The InChIKey is IVILWORUTHEFQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c1-6-2-3-11-8(4-6)7(10)5-9/h3-4,6-7H,2,5,9-10H2,1H3.
What are the key properties of 1-(4-methyl-3,4-dihydropyridin-6-yl)ethane-1,2-diamine?
1-(4-methyl-3,4-dihydropyridin-6-yl)ethane-1,2-diamine has a molecular weight of 153.23 g/mol, XLogP of 0.27, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methyl-3,4-dihydropyridin-6-yl)ethane-1,2-diamine is sourced from PubChem (CID 155132108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).