C17H24ClN3O — CID 155132143
2-[5-chloro-2-[methyl-[[(2S)-pyrrolidin-2-yl]methyl]amino]phenyl]-N,N-dimethylprop-2-enamide (PubChem CID 155132143) has the molecular formula C17H24ClN3O and a molecular weight of 321.85 g/mol. Its IUPAC name is 2-[5-chloro-2-[methyl-[[(2S)-pyrrolidin-2-yl]methyl]amino]phenyl]-N,N-dimethylprop-2-enamide.
| Compound Name | 2-[5-chloro-2-[methyl-[[(2S)-pyrrolidin-2-yl]methyl]amino]phenyl]-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 155132143 |
| Molecular Formula | C17H24ClN3O |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-[5-chloro-2-[methyl-[[(2S)-pyrrolidin-2-yl]methyl]amino]phenyl]-N,N-dimethylprop-2-enamide |
| SMILES | C=C(C(=O)N(C)C)c1cc(Cl)ccc1N(C)C[C@@H]1CCCN1 |
| InChI | InChI=1S/C17H24ClN3O/c1-12(17(22)20(2)3)15-10-13(18)7-8-16(15)21(4)11-14-6-5-9-19-14/h7-8,10,14,19H,1,5-6,9,11H2,2-4H3/t14-/m0/s1 |
| InChIKey | QMTFAMCCRZRILO-AWEZNQCLSA-N |
| XLogP | 2.63 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|