C20H28N4O4S — CID 155132280
N-[(3Z,5E)-5,7-dimethoxyocta-3,5,7-trienyl]-2-methylsulfanyl-4-morpholin-4-ylpyrimidine-5-carboxamide (PubChem CID 155132280) has the molecular formula C20H28N4O4S and a molecular weight of 420.54 g/mol. Its IUPAC name is N-[(3Z,5E)-5,7-dimethoxyocta-3,5,7-trienyl]-2-methylsulfanyl-4-morpholin-4-ylpyrimidine-5-carboxamide.
| Compound Name | N-[(3Z,5E)-5,7-dimethoxyocta-3,5,7-trienyl]-2-methylsulfanyl-4-morpholin-4-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155132280 |
| Molecular Formula | C20H28N4O4S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-[(3Z,5E)-5,7-dimethoxyocta-3,5,7-trienyl]-2-methylsulfanyl-4-morpholin-4-ylpyrimidine-5-carboxamide |
| SMILES | C=C(/C=C(\C=C/CCNC(=O)c1cnc(SC)nc1N1CCOCC1)OC)OC |
| InChI | InChI=1S/C20H28N4O4S/c1-15(26-2)13-16(27-3)7-5-6-8-21-19(25)17-14-22-20(29-4)23-18(17)24-9-11-28-12-10-24/h5,7,13-14H,1,6,8-12H2,2-4H3,(H,21,25)/b7-5-,16-13+ |
| InChIKey | WRJHSBUZRFHALJ-SVFAAYPRSA-N |
| XLogP | 2.40 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|