About N-[(1Z)-3-fluorobuta-1,3-dienyl]prop-2-enimidoyl fluoride
N-[(1Z)-3-fluorobuta-1,3-dienyl]prop-2-enimidoyl fluoride (PubChem CID 155133443) has the molecular formula C7H7F2N
and a molecular weight of 143.14 g/mol. Its IUPAC name is N-[(1Z)-3-fluorobuta-1,3-dienyl]prop-2-enimidoyl fluoride.
Molecular Properties
| Compound Name | N-[(1Z)-3-fluorobuta-1,3-dienyl]prop-2-enimidoyl fluoride |
| PubChem CID | 155133443 |
| Molecular Formula | C7H7F2N |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | N-[(1Z)-3-fluorobuta-1,3-dienyl]prop-2-enimidoyl fluoride |
| SMILES | C=C/C(F)=N/C=C\C(=C)F |
| InChI | InChI=1S/C7H7F2N/c1-3-7(9)10-5-4-6(2)8/h3-5H,1-2H2/b5-4-,10-7- |
| InChIKey | RJQBNJKKHPZQMS-WKBXPBOGSA-N |
| XLogP | 2.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z)-3-fluorobuta-1,3-dienyl]prop-2-enimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z)-3-fluorobuta-1,3-dienyl]prop-2-enimidoyl fluoride?
The IUPAC name of N-[(1Z)-3-fluorobuta-1,3-dienyl]prop-2-enimidoyl fluoride (CID 155133443) is N-[(1Z)-3-fluorobuta-1,3-dienyl]prop-2-enimidoyl fluoride.
What is the SMILES notation for N-[(1Z)-3-fluorobuta-1,3-dienyl]prop-2-enimidoyl fluoride?
The canonical SMILES for N-[(1Z)-3-fluorobuta-1,3-dienyl]prop-2-enimidoyl fluoride is C=C/C(F)=N/C=C\C(=C)F.
What is the InChIKey of N-[(1Z)-3-fluorobuta-1,3-dienyl]prop-2-enimidoyl fluoride?
The InChIKey is RJQBNJKKHPZQMS-WKBXPBOGSA-N. The full InChI is InChI=1S/C7H7F2N/c1-3-7(9)10-5-4-6(2)8/h3-5H,1-2H2/b5-4-,10-7-.
What are the key properties of N-[(1Z)-3-fluorobuta-1,3-dienyl]prop-2-enimidoyl fluoride?
N-[(1Z)-3-fluorobuta-1,3-dienyl]prop-2-enimidoyl fluoride has a molecular weight of 143.14 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-3-fluorobuta-1,3-dienyl]prop-2-enimidoyl fluoride is sourced from PubChem (CID 155133443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).