About 2-[4-[4-(3,5-dimethyl-1-adamantyl)anilino]anilino]benzoic acid
2-[4-[4-(3,5-dimethyl-1-adamantyl)anilino]anilino]benzoic acid (PubChem CID 155133863) has the molecular formula C31H34N2O2
and a molecular weight of 466.63 g/mol. Its IUPAC name is 2-[4-[4-(3,5-dimethyl-1-adamantyl)anilino]anilino]benzoic acid.
Molecular Properties
| Compound Name | 2-[4-[4-(3,5-dimethyl-1-adamantyl)anilino]anilino]benzoic acid |
| PubChem CID | 155133863 |
| Molecular Formula | C31H34N2O2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 2-[4-[4-(3,5-dimethyl-1-adamantyl)anilino]anilino]benzoic acid |
| SMILES | CC12CC3CC(C)(C1)CC(c1ccc(Nc4ccc(Nc5ccccc5C(=O)O)cc4)cc1)(C3)C2 |
| InChI | InChI=1S/C31H34N2O2/c1-29-15-21-16-30(2,18-29)20-31(17-21,19-29)22-7-9-23(10-8-22)32-24-11-13-25(14-12-24)33-27-6-4-3-5-26(27)28(34)35/h3-14,21,32-33H,15-20H2,1-2H3,(H,34,35) |
| InChIKey | LWHKOWDEDANFDQ-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-[4-(3,5-dimethyl-1-adamantyl)anilino]anilino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-(3,5-dimethyl-1-adamantyl)anilino]anilino]benzoic acid?
The IUPAC name of 2-[4-[4-(3,5-dimethyl-1-adamantyl)anilino]anilino]benzoic acid (CID 155133863) is 2-[4-[4-(3,5-dimethyl-1-adamantyl)anilino]anilino]benzoic acid.
What is the SMILES notation for 2-[4-[4-(3,5-dimethyl-1-adamantyl)anilino]anilino]benzoic acid?
The canonical SMILES for 2-[4-[4-(3,5-dimethyl-1-adamantyl)anilino]anilino]benzoic acid is CC12CC3CC(C)(C1)CC(c1ccc(Nc4ccc(Nc5ccccc5C(=O)O)cc4)cc1)(C3)C2.
What is the InChIKey of 2-[4-[4-(3,5-dimethyl-1-adamantyl)anilino]anilino]benzoic acid?
The InChIKey is LWHKOWDEDANFDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H34N2O2/c1-29-15-21-16-30(2,18-29)20-31(17-21,19-29)22-7-9-23(10-8-22)32-24-11-13-25(14-12-24)33-27-6-4-3-5-26(27)28(34)35/h3-14,21,32-33H,15-20H2,1-2H3,(H,34,35).
What are the key properties of 2-[4-[4-(3,5-dimethyl-1-adamantyl)anilino]anilino]benzoic acid?
2-[4-[4-(3,5-dimethyl-1-adamantyl)anilino]anilino]benzoic acid has a molecular weight of 466.63 g/mol, XLogP of 8.12, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-(3,5-dimethyl-1-adamantyl)anilino]anilino]benzoic acid is sourced from PubChem (CID 155133863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).