About 1-N-[4-(1-adamantyl)-2-chlorophenyl]-4-N-pyridin-2-ylbenzene-1,4-diamine
1-N-[4-(1-adamantyl)-2-chlorophenyl]-4-N-pyridin-2-ylbenzene-1,4-diamine (PubChem CID 155134151) has the molecular formula C27H28ClN3
and a molecular weight of 430.00 g/mol. Its IUPAC name is 1-N-[4-(1-adamantyl)-2-chlorophenyl]-4-N-pyridin-2-ylbenzene-1,4-diamine.
Molecular Properties
| Compound Name | 1-N-[4-(1-adamantyl)-2-chlorophenyl]-4-N-pyridin-2-ylbenzene-1,4-diamine |
| PubChem CID | 155134151 |
| Molecular Formula | C27H28ClN3 |
| Molecular Weight | 430.00 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 1-N-[4-(1-adamantyl)-2-chlorophenyl]-4-N-pyridin-2-ylbenzene-1,4-diamine |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=CC(=C(C=C4)NC5=CC=C(C=C5)NC6=CC=CC=N6)Cl |
| InChI | InChI=1S/C27H28ClN3/c28-24-14-21(27-15-18-11-19(16-27)13-20(12-18)17-27)4-9-25(24)30-22-5-7-23(8-6-22)31-26-3-1-2-10-29-26/h1-10,14,18-20,30H,11-13,15-17H2,(H,29,31) |
| InChIKey | UPYSNVJRZKJCFC-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 37.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | 574 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.00 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-N-[4-(1-adamantyl)-2-chlorophenyl]-4-N-pyridin-2-ylbenzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[4-(1-adamantyl)-2-chlorophenyl]-4-N-pyridin-2-ylbenzene-1,4-diamine?
The IUPAC name of 1-N-[4-(1-adamantyl)-2-chlorophenyl]-4-N-pyridin-2-ylbenzene-1,4-diamine (CID 155134151) is 1-N-[4-(1-adamantyl)-2-chlorophenyl]-4-N-pyridin-2-ylbenzene-1,4-diamine.
What is the SMILES notation for 1-N-[4-(1-adamantyl)-2-chlorophenyl]-4-N-pyridin-2-ylbenzene-1,4-diamine?
The canonical SMILES for 1-N-[4-(1-adamantyl)-2-chlorophenyl]-4-N-pyridin-2-ylbenzene-1,4-diamine is C1C2CC3CC1CC(C2)(C3)C4=CC(=C(C=C4)NC5=CC=C(C=C5)NC6=CC=CC=N6)Cl.
What is the InChIKey of 1-N-[4-(1-adamantyl)-2-chlorophenyl]-4-N-pyridin-2-ylbenzene-1,4-diamine?
The InChIKey is UPYSNVJRZKJCFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28ClN3/c28-24-14-21(27-15-18-11-19(16-27)13-20(12-18)17-27)4-9-25(24)30-22-5-7-23(8-6-22)31-26-3-1-2-10-29-26/h1-10,14,18-20,30H,11-13,15-17H2,(H,29,31).
What are the key properties of 1-N-[4-(1-adamantyl)-2-chlorophenyl]-4-N-pyridin-2-ylbenzene-1,4-diamine?
1-N-[4-(1-adamantyl)-2-chlorophenyl]-4-N-pyridin-2-ylbenzene-1,4-diamine has a molecular weight of 430.00 g/mol, XLogP of 8.30, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[4-(1-adamantyl)-2-chlorophenyl]-4-N-pyridin-2-ylbenzene-1,4-diamine is sourced from PubChem (CID 155134151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).