C19H16F2N6O2 — CID 155134902
N-[4-amino-3-(1,2-oxazole-4-carboximidoyl)phenyl]-2,6-difluoro-3-methanimidoyl-4-(methylamino)benzamide (PubChem CID 155134902) has the molecular formula C19H16F2N6O2 and a molecular weight of 398.37 g/mol. Its IUPAC name is N-[4-amino-3-(1,2-oxazole-4-carboximidoyl)phenyl]-2,6-difluoro-3-methanimidoyl-4-(methylamino)benzamide.
| Compound Name | N-[4-amino-3-(1,2-oxazole-4-carboximidoyl)phenyl]-2,6-difluoro-3-methanimidoyl-4-(methylamino)benzamide |
|---|---|
| PubChem CID | 155134902 |
| Molecular Formula | C19H16F2N6O2 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-[4-amino-3-(1,2-oxazole-4-carboximidoyl)phenyl]-2,6-difluoro-3-methanimidoyl-4-(methylamino)benzamide |
| SMILES | [H]/N=C(\c1cnoc1)c1cc(NC(=O)c2c(F)cc(NC)c(/C=N/[H])c2F)ccc1N |
| InChI | InChI=1S/C19H16F2N6O2/c1-25-15-5-13(20)16(17(21)12(15)6-22)19(28)27-10-2-3-14(23)11(4-10)18(24)9-7-26-29-8-9/h2-8,22,24-25H,23H2,1H3,(H,27,28)/b22-6+,24-18+ |
| InChIKey | OKKCUVBJLJAFDK-GAFHEPESSA-N |
| XLogP | 3.24 |
| TPSA | 140.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|