C37H38N2O5 — CID 155134942
4-[[(8'aR)-7'-anilino-6'-methyl-3-oxospiro[2-benzofuran-1,9'-8a,10a-dihydroxanthene]-3'-yl]-ethylamino]butyl 2-methylprop-2-enoate (PubChem CID 155134942) has the molecular formula C37H38N2O5 and a molecular weight of 590.72 g/mol. Its IUPAC name is 4-[[(8'aR)-7'-anilino-6'-methyl-3-oxospiro[2-benzofuran-1,9'-8a,10a-dihydroxanthene]-3'-yl]-ethylamino]butyl 2-methylprop-2-enoate.
| Compound Name | 4-[[(8'aR)-7'-anilino-6'-methyl-3-oxospiro[2-benzofuran-1,9'-8a,10a-dihydroxanthene]-3'-yl]-ethylamino]butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155134942 |
| Molecular Formula | C37H38N2O5 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | 4-[[(8'aR)-7'-anilino-6'-methyl-3-oxospiro[2-benzofuran-1,9'-8a,10a-dihydroxanthene]-3'-yl]-ethylamino]butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCN(CC)c1ccc2c(c1)OC1C=C(C)C(Nc3ccccc3)=C[C@H]1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C37H38N2O5/c1-5-39(19-11-12-20-42-35(40)24(2)3)27-17-18-30-34(22-27)43-33-21-25(4)32(38-26-13-7-6-8-14-26)23-31(33)37(30)29-16-10-9-15-28(29)36(41)44-37/h6-10,13-18,21-23,31,33,38H,2,5,11-12,19-20H2,1,3-4H3/t31-,33?,37?/m1/s1 |
| InChIKey | QJWVMODKQYPMGF-MGXPEAIDSA-N |
| XLogP | 7.16 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|