C26H21F3N2O2S — CID 155135257
N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-propan-2-yl-7-(2,3,6-trifluorophenyl)thieno[3,2-b]pyridine-2-carboxamide (PubChem CID 155135257) has the molecular formula C26H21F3N2O2S and a molecular weight of 482.53 g/mol. Its IUPAC name is N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-propan-2-yl-7-(2,3,6-trifluorophenyl)thieno[3,2-b]pyridine-2-carboxamide.
| Compound Name | N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-propan-2-yl-7-(2,3,6-trifluorophenyl)thieno[3,2-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155135257 |
| Molecular Formula | C26H21F3N2O2S |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-propan-2-yl-7-(2,3,6-trifluorophenyl)thieno[3,2-b]pyridine-2-carboxamide |
| SMILES | CC(C)c1c(C(=O)N[C@H]2CCOc3ccccc32)sc2c(-c3c(F)ccc(F)c3F)ccnc12 |
| InChI | InChI=1S/C26H21F3N2O2S/c1-13(2)20-23-24(15(9-11-30-23)21-16(27)7-8-17(28)22(21)29)34-25(20)26(32)31-18-10-12-33-19-6-4-3-5-14(18)19/h3-9,11,13,18H,10,12H2,1-2H3,(H,31,32)/t18-/m0/s1 |
| InChIKey | CQEZQYXYIXGBPG-SFHVURJKSA-N |
| XLogP | 6.76 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|