C74H42F6N4O2S — CID 155135823
7-[4-[3,6-bis[4-(trifluoromethyl)phenyl]carbazol-9-yl]phenyl]-N,N-bis(4-dibenzofuran-2-ylphenyl)-2,1,3-benzothiadiazol-4-amine (PubChem CID 155135823) has the molecular formula C74H42F6N4O2S and a molecular weight of 1165.23 g/mol. Its IUPAC name is 7-[4-[3,6-bis[4-(trifluoromethyl)phenyl]carbazol-9-yl]phenyl]-N,N-bis(4-dibenzofuran-2-ylphenyl)-2,1,3-benzothiadiazol-4-amine.
| Compound Name | 7-[4-[3,6-bis[4-(trifluoromethyl)phenyl]carbazol-9-yl]phenyl]-N,N-bis(4-dibenzofuran-2-ylphenyl)-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 155135823 |
| Molecular Formula | C74H42F6N4O2S |
| Molecular Weight | 1165.23 g/mol |
| Exact Mass | 1164.29 |
| IUPAC Name | 7-[4-[3,6-bis[4-(trifluoromethyl)phenyl]carbazol-9-yl]phenyl]-N,N-bis(4-dibenzofuran-2-ylphenyl)-2,1,3-benzothiadiazol-4-amine |
| SMILES | FC(F)(F)c1ccc(-c2ccc3c(c2)c2cc(-c4ccc(C(F)(F)F)cc4)ccc2n3-c2ccc(-c3ccc(N(c4ccc(-c5ccc6oc7ccccc7c6c5)cc4)c4ccc(-c5ccc6oc7ccccc7c6c5)cc4)c4nsnc34)cc2)cc1 |
| InChI | InChI=1S/C74H42F6N4O2S/c75-73(76,77)52-23-9-43(10-24-52)48-19-34-64-60(39-48)61-40-49(44-11-25-53(26-12-44)74(78,79)80)20-35-65(61)84(64)56-31-17-47(18-32-56)57-33-36-66(72-71(57)81-87-82-72)83(54-27-13-45(14-28-54)50-21-37-69-62(41-50)58-5-1-3-7-67(58)85-69)55-29-15-46(16-30-55)51-22-38-70-63(42-51)59-6-2-4-8-68(59)86-70/h1-42H |
| InChIKey | ZEUJXOUICRXUMA-UHFFFAOYSA-N |
| XLogP | 22.43 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1165.23 |
| LogP ≤ 5 | 22.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |