C29H23FN8O2S — CID 155136269
(3R)-9-fluoro-3-[[5-[2-(1-methylcyclopropyl)-5-(2-methylpyrimidin-5-yl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 155136269) has the molecular formula C29H23FN8O2S and a molecular weight of 566.62 g/mol. Its IUPAC name is (3R)-9-fluoro-3-[[5-[2-(1-methylcyclopropyl)-5-(2-methylpyrimidin-5-yl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | (3R)-9-fluoro-3-[[5-[2-(1-methylcyclopropyl)-5-(2-methylpyrimidin-5-yl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 155136269 |
| Molecular Formula | C29H23FN8O2S |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | (3R)-9-fluoro-3-[[5-[2-(1-methylcyclopropyl)-5-(2-methylpyrimidin-5-yl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | Cc1ncc(-c2sc(C3(C)CC3)nc2-c2nnc(N[C@@H]3N=C(c4ccccc4)c4cccc(F)c4NC3=O)o2)cn1 |
| InChI | InChI=1S/C29H23FN8O2S/c1-15-31-13-17(14-32-15)23-22(35-27(41-23)29(2)11-12-29)26-37-38-28(40-26)36-24-25(39)34-21-18(9-6-10-19(21)30)20(33-24)16-7-4-3-5-8-16/h3-10,13-14,24H,11-12H2,1-2H3,(H,34,39)(H,36,38)/t24-/m0/s1 |
| InChIKey | LEXRCTHVUVNSEA-DEOSSOPVSA-N |
| XLogP | 5.38 |
| TPSA | 131.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |