C30H25FN8O2S — CID 155136272
(3R)-3-[[5-[5-(2-ethylpyrimidin-5-yl)-2-(1-methylcyclopropyl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-9-fluoro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 155136272) has the molecular formula C30H25FN8O2S and a molecular weight of 580.65 g/mol. Its IUPAC name is (3R)-3-[[5-[5-(2-ethylpyrimidin-5-yl)-2-(1-methylcyclopropyl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-9-fluoro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | (3R)-3-[[5-[5-(2-ethylpyrimidin-5-yl)-2-(1-methylcyclopropyl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-9-fluoro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 155136272 |
| Molecular Formula | C30H25FN8O2S |
| Molecular Weight | 580.65 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | (3R)-3-[[5-[5-(2-ethylpyrimidin-5-yl)-2-(1-methylcyclopropyl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-9-fluoro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | CCc1ncc(-c2sc(C3(C)CC3)nc2-c2nnc(N[C@@H]3N=C(c4ccccc4)c4cccc(F)c4NC3=O)o2)cn1 |
| InChI | InChI=1S/C30H25FN8O2S/c1-3-20-32-14-17(15-33-20)24-23(36-28(42-24)30(2)12-13-30)27-38-39-29(41-27)37-25-26(40)35-22-18(10-7-11-19(22)31)21(34-25)16-8-5-4-6-9-16/h4-11,14-15,25H,3,12-13H2,1-2H3,(H,35,40)(H,37,39)/t25-/m0/s1 |
| InChIKey | LJJUISOTCFUFOL-VWLOTQADSA-N |
| XLogP | 5.63 |
| TPSA | 131.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.65 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |