C30H43N5O3 — CID 155136661
(E,2E)-2-[amino-(methylideneamino)methylidene]-N-(4-hydroxycyclohexyl)-4-[4-[(1S,5R)-3-(2-morpholin-4-ylethyl)-3-azabicyclo[3.1.0]hexan-1-yl]phenyl]pent-3-enamide (PubChem CID 155136661) has the molecular formula C30H43N5O3 and a molecular weight of 521.71 g/mol. Its IUPAC name is (E,2E)-2-[amino-(methylideneamino)methylidene]-N-(4-hydroxycyclohexyl)-4-[4-[(1S,5R)-3-(2-morpholin-4-ylethyl)-3-azabicyclo[3.1.0]hexan-1-yl]phenyl]pent-3-enamide.
| Compound Name | (E,2E)-2-[amino-(methylideneamino)methylidene]-N-(4-hydroxycyclohexyl)-4-[4-[(1S,5R)-3-(2-morpholin-4-ylethyl)-3-azabicyclo[3.1.0]hexan-1-yl]phenyl]pent-3-enamide |
|---|---|
| PubChem CID | 155136661 |
| Molecular Formula | C30H43N5O3 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.34 |
| IUPAC Name | (E,2E)-2-[amino-(methylideneamino)methylidene]-N-(4-hydroxycyclohexyl)-4-[4-[(1S,5R)-3-(2-morpholin-4-ylethyl)-3-azabicyclo[3.1.0]hexan-1-yl]phenyl]pent-3-enamide |
| SMILES | C=N/C(N)=C(\C=C(/C)c1ccc([C@]23C[C@H]2CN(CCN2CCOCC2)C3)cc1)C(=O)NC1CCC(O)CC1 |
| InChI | InChI=1S/C30H43N5O3/c1-21(17-27(28(31)32-2)29(37)33-25-7-9-26(36)10-8-25)22-3-5-23(6-4-22)30-18-24(30)19-35(20-30)12-11-34-13-15-38-16-14-34/h3-6,17,24-26,36H,2,7-16,18-20,31H2,1H3,(H,33,37)/b21-17+,28-27+/t24-,25?,26?,30+/m0/s1 |
| InChIKey | KXBMTQRFKUZRMW-QKHUHUKGSA-N |
| XLogP | 2.29 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|