C11H14F3N — CID 155136816
2-[(2Z,4E)-1,5,6-trifluorohepta-2,4,6-trien-2-yl]pyrrolidine (PubChem CID 155136816) has the molecular formula C11H14F3N and a molecular weight of 217.23 g/mol. Its IUPAC name is 2-[(2Z,4E)-1,5,6-trifluorohepta-2,4,6-trien-2-yl]pyrrolidine.
| Compound Name | 2-[(2Z,4E)-1,5,6-trifluorohepta-2,4,6-trien-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 155136816 |
| Molecular Formula | C11H14F3N |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 2-[(2Z,4E)-1,5,6-trifluorohepta-2,4,6-trien-2-yl]pyrrolidine |
| SMILES | C=C(F)/C(F)=C\C=C(/CF)C1CCCN1 |
| InChI | InChI=1S/C11H14F3N/c1-8(13)10(14)5-4-9(7-12)11-3-2-6-15-11/h4-5,11,15H,1-3,6-7H2/b9-4+,10-5+ |
| InChIKey | GAOVMAAZVZENLG-LUZURFALSA-N |
| XLogP | 2.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|