C28H20F3N2O2P — CID 155137434
10-dimethylphosphoryl-17-[4-(trifluoromethoxy)phenyl]-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,4,6,8(13),9,11,15(20),16,18-decaene (PubChem CID 155137434) has the molecular formula C28H20F3N2O2P and a molecular weight of 504.45 g/mol. Its IUPAC name is 10-dimethylphosphoryl-17-[4-(trifluoromethoxy)phenyl]-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,4,6,8(13),9,11,15(20),16,18-decaene.
| Compound Name | 10-dimethylphosphoryl-17-[4-(trifluoromethoxy)phenyl]-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,4,6,8(13),9,11,15(20),16,18-decaene |
|---|---|
| PubChem CID | 155137434 |
| Molecular Formula | C28H20F3N2O2P |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 10-dimethylphosphoryl-17-[4-(trifluoromethoxy)phenyl]-14,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2,4,6,8(13),9,11,15(20),16,18-decaene |
| SMILES | CP(C)(=O)c1ccc2c(c1)c1ccccc1c1nc3ccc(-c4ccc(OC(F)(F)F)cc4)cc3n21 |
| InChI | InChI=1S/C28H20F3N2O2P/c1-36(2,34)20-12-14-25-23(16-20)21-5-3-4-6-22(21)27-32-24-13-9-18(15-26(24)33(25)27)17-7-10-19(11-8-17)35-28(29,30)31/h3-16H,1-2H3 |
| InChIKey | NXXGABRECZXRFH-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|