C16H20ClNO3 — CID 155137573
(4R)-4-(2-chloroethyl)-1-[(1S)-1-cyclohex-2-en-1-ylprop-2-enyl]-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 155137573) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is (4R)-4-(2-chloroethyl)-1-[(1S)-1-cyclohex-2-en-1-ylprop-2-enyl]-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (4R)-4-(2-chloroethyl)-1-[(1S)-1-cyclohex-2-en-1-ylprop-2-enyl]-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 155137573 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (4R)-4-(2-chloroethyl)-1-[(1S)-1-cyclohex-2-en-1-ylprop-2-enyl]-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | C=C[C@@H](C1C=CCCC1)C12NC(=O)[C@H](CCCl)C1OC2=O |
| InChI | InChI=1S/C16H20ClNO3/c1-2-12(10-6-4-3-5-7-10)16-13(21-15(16)20)11(8-9-17)14(19)18-16/h2,4,6,10-13H,1,3,5,7-9H2,(H,18,19)/t10?,11-,12+,13?,16?/m1/s1 |
| InChIKey | ZZDMPDOEIXGVRV-KILXCXBTSA-N |
| XLogP | 2.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|