C20H30N2O5S — CID 155138068
tert-butyl N-[(2R)-3-benzylsulfanyl-1-[(2S)-2-(dihydroxymethyl)pyrrolidin-1-yl]-1-oxopropan-2-yl]carbamate (PubChem CID 155138068) has the molecular formula C20H30N2O5S and a molecular weight of 410.54 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-benzylsulfanyl-1-[(2S)-2-(dihydroxymethyl)pyrrolidin-1-yl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-benzylsulfanyl-1-[(2S)-2-(dihydroxymethyl)pyrrolidin-1-yl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 155138068 |
| Molecular Formula | C20H30N2O5S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | tert-butyl N-[(2R)-3-benzylsulfanyl-1-[(2S)-2-(dihydroxymethyl)pyrrolidin-1-yl]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CSCc1ccccc1)C(=O)N1CCC[C@H]1C(O)O |
| InChI | InChI=1S/C20H30N2O5S/c1-20(2,3)27-19(26)21-15(13-28-12-14-8-5-4-6-9-14)17(23)22-11-7-10-16(22)18(24)25/h4-6,8-9,15-16,18,24-25H,7,10-13H2,1-3H3,(H,21,26)/t15-,16-/m0/s1 |
| InChIKey | FALFZZLTGZVJRT-HOTGVXAUSA-N |
| XLogP | 2.11 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|