About (1Z,3Z)-N-tert-butyl-1-(methylideneamino)penta-1,3-dien-1-amine
(1Z,3Z)-N-tert-butyl-1-(methylideneamino)penta-1,3-dien-1-amine (PubChem CID 155138134) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is (1Z,3Z)-N-tert-butyl-1-(methylideneamino)penta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1Z,3Z)-N-tert-butyl-1-(methylideneamino)penta-1,3-dien-1-amine |
| PubChem CID | 155138134 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (1Z,3Z)-N-tert-butyl-1-(methylideneamino)penta-1,3-dien-1-amine |
| SMILES | C=N/C(=C\C=C/C)NC(C)(C)C |
| InChI | InChI=1S/C10H18N2/c1-6-7-8-9(11-5)12-10(2,3)4/h6-8,12H,5H2,1-4H3/b7-6-,9-8+ |
| InChIKey | YHTSAMWGHYFOQR-NMMTYZSQSA-N |
| XLogP | 2.49 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3Z)-N-tert-butyl-1-(methylideneamino)penta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3Z)-N-tert-butyl-1-(methylideneamino)penta-1,3-dien-1-amine?
The IUPAC name of (1Z,3Z)-N-tert-butyl-1-(methylideneamino)penta-1,3-dien-1-amine (CID 155138134) is (1Z,3Z)-N-tert-butyl-1-(methylideneamino)penta-1,3-dien-1-amine.
What is the SMILES notation for (1Z,3Z)-N-tert-butyl-1-(methylideneamino)penta-1,3-dien-1-amine?
The canonical SMILES for (1Z,3Z)-N-tert-butyl-1-(methylideneamino)penta-1,3-dien-1-amine is C=N/C(=C\C=C/C)NC(C)(C)C.
What is the InChIKey of (1Z,3Z)-N-tert-butyl-1-(methylideneamino)penta-1,3-dien-1-amine?
The InChIKey is YHTSAMWGHYFOQR-NMMTYZSQSA-N. The full InChI is InChI=1S/C10H18N2/c1-6-7-8-9(11-5)12-10(2,3)4/h6-8,12H,5H2,1-4H3/b7-6-,9-8+.
What are the key properties of (1Z,3Z)-N-tert-butyl-1-(methylideneamino)penta-1,3-dien-1-amine?
(1Z,3Z)-N-tert-butyl-1-(methylideneamino)penta-1,3-dien-1-amine has a molecular weight of 166.27 g/mol, XLogP of 2.49, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3Z)-N-tert-butyl-1-(methylideneamino)penta-1,3-dien-1-amine is sourced from PubChem (CID 155138134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).