C18H18N2O — CID 155138491
1-[(5S,7S)-2,5-dimethyl-7-phenyl-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridin-6-yl]prop-2-yn-1-one (PubChem CID 155138491) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-[(5S,7S)-2,5-dimethyl-7-phenyl-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridin-6-yl]prop-2-yn-1-one.
| Compound Name | 1-[(5S,7S)-2,5-dimethyl-7-phenyl-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridin-6-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 155138491 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 1-[(5S,7S)-2,5-dimethyl-7-phenyl-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridin-6-yl]prop-2-yn-1-one |
| SMILES | C#CC(=O)N1[C@@H](c2ccccc2)c2[nH]c(C)cc2C[C@@H]1C |
| InChI | InChI=1S/C18H18N2O/c1-4-16(21)20-13(3)11-15-10-12(2)19-17(15)18(20)14-8-6-5-7-9-14/h1,5-10,13,18-19H,11H2,2-3H3/t13-,18-/m0/s1 |
| InChIKey | IEQAEGMNYOWXPP-UGSOOPFHSA-N |
| XLogP | 2.82 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|