C21H34O2 — CID 155138801
(1R,3S,5R,7R,8R,10S,13R)-5-but-3-enyl-5,7,9,9,13-pentamethyl-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane (PubChem CID 155138801) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (1R,3S,5R,7R,8R,10S,13R)-5-but-3-enyl-5,7,9,9,13-pentamethyl-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane.
| Compound Name | (1R,3S,5R,7R,8R,10S,13R)-5-but-3-enyl-5,7,9,9,13-pentamethyl-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane |
|---|---|
| PubChem CID | 155138801 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (1R,3S,5R,7R,8R,10S,13R)-5-but-3-enyl-5,7,9,9,13-pentamethyl-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane |
| SMILES | C=CCC[C@]1(C)O[C@H]2C[C@@]34C[C@H](C(C)(C)[C@@H]3CC[C@H]4C)[C@@]2(C)O1 |
| InChI | InChI=1S/C21H34O2/c1-7-8-11-19(5)22-17-13-21-12-16(20(17,6)23-19)18(3,4)15(21)10-9-14(21)2/h7,14-17H,1,8-13H2,2-6H3/t14-,15+,16-,17+,19-,20-,21-/m1/s1 |
| InChIKey | KGHTVAUTPXVMIO-HWPXFKOISA-N |
| XLogP | 5.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|