About 1-[5-(aziridin-1-yl)-2,5-dimethylhexan-2-yl]azirine
1-[5-(aziridin-1-yl)-2,5-dimethylhexan-2-yl]azirine (PubChem CID 155138986) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-[5-(aziridin-1-yl)-2,5-dimethylhexan-2-yl]azirine.
Molecular Properties
| Compound Name | 1-[5-(aziridin-1-yl)-2,5-dimethylhexan-2-yl]azirine |
| PubChem CID | 155138986 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1-[5-(aziridin-1-yl)-2,5-dimethylhexan-2-yl]azirine |
| SMILES | CC(C)(CCC(C)(C)N1CC1)N1C=C1 |
| InChI | InChI=1S/C12H22N2/c1-11(2,13-7-8-13)5-6-12(3,4)14-9-10-14/h7-8H,5-6,9-10H2,1-4H3 |
| InChIKey | NYTFTRJUVCPOGO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(aziridin-1-yl)-2,5-dimethylhexan-2-yl]azirine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(aziridin-1-yl)-2,5-dimethylhexan-2-yl]azirine?
The IUPAC name of 1-[5-(aziridin-1-yl)-2,5-dimethylhexan-2-yl]azirine (CID 155138986) is 1-[5-(aziridin-1-yl)-2,5-dimethylhexan-2-yl]azirine.
What is the SMILES notation for 1-[5-(aziridin-1-yl)-2,5-dimethylhexan-2-yl]azirine?
The canonical SMILES for 1-[5-(aziridin-1-yl)-2,5-dimethylhexan-2-yl]azirine is CC(C)(CCC(C)(C)N1CC1)N1C=C1.
What is the InChIKey of 1-[5-(aziridin-1-yl)-2,5-dimethylhexan-2-yl]azirine?
The InChIKey is NYTFTRJUVCPOGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2/c1-11(2,13-7-8-13)5-6-12(3,4)14-9-10-14/h7-8H,5-6,9-10H2,1-4H3.
What are the key properties of 1-[5-(aziridin-1-yl)-2,5-dimethylhexan-2-yl]azirine?
1-[5-(aziridin-1-yl)-2,5-dimethylhexan-2-yl]azirine has a molecular weight of 194.32 g/mol, XLogP of 2.43, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(aziridin-1-yl)-2,5-dimethylhexan-2-yl]azirine is sourced from PubChem (CID 155138986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).