C20H34O2 — CID 155139023
(2S,3aR,5aS,8R,8aR,9aS)-2-but-3-enyl-3a,5,5,8,8a-pentamethyl-5a,6,7,8,9,9a-hexahydro-4H-azuleno[5,6-d][1,3]dioxole (PubChem CID 155139023) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (2S,3aR,5aS,8R,8aR,9aS)-2-but-3-enyl-3a,5,5,8,8a-pentamethyl-5a,6,7,8,9,9a-hexahydro-4H-azuleno[5,6-d][1,3]dioxole.
| Compound Name | (2S,3aR,5aS,8R,8aR,9aS)-2-but-3-enyl-3a,5,5,8,8a-pentamethyl-5a,6,7,8,9,9a-hexahydro-4H-azuleno[5,6-d][1,3]dioxole |
|---|---|
| PubChem CID | 155139023 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (2S,3aR,5aS,8R,8aR,9aS)-2-but-3-enyl-3a,5,5,8,8a-pentamethyl-5a,6,7,8,9,9a-hexahydro-4H-azuleno[5,6-d][1,3]dioxole |
| SMILES | C=CCC[C@H]1O[C@H]2C[C@]3(C)[C@H](C)CC[C@H]3C(C)(C)C[C@@]2(C)O1 |
| InChI | InChI=1S/C20H34O2/c1-7-8-9-17-21-16-12-19(5)14(2)10-11-15(19)18(3,4)13-20(16,6)22-17/h7,14-17H,1,8-13H2,2-6H3/t14-,15+,16+,17+,19-,20-/m1/s1 |
| InChIKey | RRHFFGBCSICBGZ-QRNRZKQXSA-N |
| XLogP | 5.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|