C19H30O2 — CID 155139291
(2R,3aR,5aR,8R,9aS)-3a,5,5,8-tetramethylspiro[4,5a,6,7,8,8a,9,9a-octahydroazuleno[5,6-d][1,3]dioxole-2,3'-cyclopentene] (PubChem CID 155139291) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (2R,3aR,5aR,8R,9aS)-3a,5,5,8-tetramethylspiro[4,5a,6,7,8,8a,9,9a-octahydroazuleno[5,6-d][1,3]dioxole-2,3'-cyclopentene].
| Compound Name | (2R,3aR,5aR,8R,9aS)-3a,5,5,8-tetramethylspiro[4,5a,6,7,8,8a,9,9a-octahydroazuleno[5,6-d][1,3]dioxole-2,3'-cyclopentene] |
|---|---|
| PubChem CID | 155139291 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (2R,3aR,5aR,8R,9aS)-3a,5,5,8-tetramethylspiro[4,5a,6,7,8,8a,9,9a-octahydroazuleno[5,6-d][1,3]dioxole-2,3'-cyclopentene] |
| SMILES | C[C@@H]1CC[C@@H]2C1C[C@@H]1O[C@@]3(C=CCC3)O[C@]1(C)CC2(C)C |
| InChI | InChI=1S/C19H30O2/c1-13-7-8-15-14(13)11-16-18(4,12-17(15,2)3)21-19(20-16)9-5-6-10-19/h5,9,13-16H,6-8,10-12H2,1-4H3/t13-,14?,15-,16+,18-,19+/m1/s1 |
| InChIKey | YIIZRVZNQUIPRZ-PGVAICEUSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|