About 6-(4-fluorophenyl)-2,6-dimethyl-N-(oxan-4-ylmethyl)hept-2-en-4-amine
6-(4-fluorophenyl)-2,6-dimethyl-N-(oxan-4-ylmethyl)hept-2-en-4-amine (PubChem CID 155139308) has the molecular formula C21H32FNO
and a molecular weight of 333.49 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-2,6-dimethyl-N-(oxan-4-ylmethyl)hept-2-en-4-amine.
Molecular Properties
| Compound Name | 6-(4-fluorophenyl)-2,6-dimethyl-N-(oxan-4-ylmethyl)hept-2-en-4-amine |
| PubChem CID | 155139308 |
| Molecular Formula | C21H32FNO |
| Molecular Weight | 333.49 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | 6-(4-fluorophenyl)-2,6-dimethyl-N-(oxan-4-ylmethyl)hept-2-en-4-amine |
| SMILES | CC(C)=CC(CC(C)(C)c1ccc(F)cc1)NCC1CCOCC1 |
| InChI | InChI=1S/C21H32FNO/c1-16(2)13-20(23-15-17-9-11-24-12-10-17)14-21(3,4)18-5-7-19(22)8-6-18/h5-8,13,17,20,23H,9-12,14-15H2,1-4H3 |
| InChIKey | GGPRTLLFCHFHSG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-fluorophenyl)-2,6-dimethyl-N-(oxan-4-ylmethyl)hept-2-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-fluorophenyl)-2,6-dimethyl-N-(oxan-4-ylmethyl)hept-2-en-4-amine?
The IUPAC name of 6-(4-fluorophenyl)-2,6-dimethyl-N-(oxan-4-ylmethyl)hept-2-en-4-amine (CID 155139308) is 6-(4-fluorophenyl)-2,6-dimethyl-N-(oxan-4-ylmethyl)hept-2-en-4-amine.
What is the SMILES notation for 6-(4-fluorophenyl)-2,6-dimethyl-N-(oxan-4-ylmethyl)hept-2-en-4-amine?
The canonical SMILES for 6-(4-fluorophenyl)-2,6-dimethyl-N-(oxan-4-ylmethyl)hept-2-en-4-amine is CC(C)=CC(CC(C)(C)c1ccc(F)cc1)NCC1CCOCC1.
What is the InChIKey of 6-(4-fluorophenyl)-2,6-dimethyl-N-(oxan-4-ylmethyl)hept-2-en-4-amine?
The InChIKey is GGPRTLLFCHFHSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32FNO/c1-16(2)13-20(23-15-17-9-11-24-12-10-17)14-21(3,4)18-5-7-19(22)8-6-18/h5-8,13,17,20,23H,9-12,14-15H2,1-4H3.
What are the key properties of 6-(4-fluorophenyl)-2,6-dimethyl-N-(oxan-4-ylmethyl)hept-2-en-4-amine?
6-(4-fluorophenyl)-2,6-dimethyl-N-(oxan-4-ylmethyl)hept-2-en-4-amine has a molecular weight of 333.49 g/mol, XLogP of 4.84, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-fluorophenyl)-2,6-dimethyl-N-(oxan-4-ylmethyl)hept-2-en-4-amine is sourced from PubChem (CID 155139308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).