C18H28N2O2 — CID 155139571
(4aR,6S,8aR)-4a,9,9-trimethyl-6-morpholin-4-yl-4,5,6,7,8,8a-hexahydrobenzo[f][1,2]benzoxazole (PubChem CID 155139571) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is (4aR,6S,8aR)-4a,9,9-trimethyl-6-morpholin-4-yl-4,5,6,7,8,8a-hexahydrobenzo[f][1,2]benzoxazole.
| Compound Name | (4aR,6S,8aR)-4a,9,9-trimethyl-6-morpholin-4-yl-4,5,6,7,8,8a-hexahydrobenzo[f][1,2]benzoxazole |
|---|---|
| PubChem CID | 155139571 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (4aR,6S,8aR)-4a,9,9-trimethyl-6-morpholin-4-yl-4,5,6,7,8,8a-hexahydrobenzo[f][1,2]benzoxazole |
| SMILES | CC1(C)c2oncc2C[C@]2(C)C[C@@H](N3CCOCC3)CC[C@@H]12 |
| InChI | InChI=1S/C18H28N2O2/c1-17(2)15-5-4-14(20-6-8-21-9-7-20)11-18(15,3)10-13-12-19-22-16(13)17/h12,14-15H,4-11H2,1-3H3/t14-,15-,18+/m0/s1 |
| InChIKey | SEYSULIXICDKFH-RLFYNMQTSA-N |
| XLogP | 3.02 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |