C58H22F6N10O2 — CID 155139741
(3E,7E)-3,7-bis[cyano-(3,5-dicyanophenyl)methylidene]-2,6-dipyridin-2-yl-4,8-bis[4-(trifluoromethoxy)phenyl]-s-indacene-1,5-dicarbonitrile (PubChem CID 155139741) has the molecular formula C58H22F6N10O2 and a molecular weight of 1004.87 g/mol. Its IUPAC name is (3E,7E)-3,7-bis[cyano-(3,5-dicyanophenyl)methylidene]-2,6-dipyridin-2-yl-4,8-bis[4-(trifluoromethoxy)phenyl]-s-indacene-1,5-dicarbonitrile.
| Compound Name | (3E,7E)-3,7-bis[cyano-(3,5-dicyanophenyl)methylidene]-2,6-dipyridin-2-yl-4,8-bis[4-(trifluoromethoxy)phenyl]-s-indacene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 155139741 |
| Molecular Formula | C58H22F6N10O2 |
| Molecular Weight | 1004.87 g/mol |
| Exact Mass | 1004.18 |
| IUPAC Name | (3E,7E)-3,7-bis[cyano-(3,5-dicyanophenyl)methylidene]-2,6-dipyridin-2-yl-4,8-bis[4-(trifluoromethoxy)phenyl]-s-indacene-1,5-dicarbonitrile |
| SMILES | N#CC1=C(c2ccccn2)/C(=C(/C#N)c2cc(C#N)cc(C#N)c2)c2c1c(-c1ccc(OC(F)(F)F)cc1)c1c(c2-c2ccc(OC(F)(F)F)cc2)C(C#N)=C(c2ccccn2)/C1=C(/C#N)c1cc(C#N)cc(C#N)c1 |
| InChI | InChI=1S/C58H22F6N10O2/c59-57(60,61)75-39-11-7-35(8-12-39)47-53-43(29-71)49(45-5-1-3-15-73-45)51(41(27-69)37-19-31(23-65)17-32(20-37)24-66)55(53)48(36-9-13-40(14-10-36)76-58(62,63)64)54-44(30-72)50(46-6-2-4-16-74-46)52(56(47)54)42(28-70)38-21-33(25-67)18-34(22-38)26-68/h1-22H/b51-41+,52-42+ |
| InChIKey | QQYSVGLZLQPJDW-LALCGSRASA-N |
| XLogP | 12.86 |
| TPSA | 234.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1004.87 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|