About N'-[(1Z)-2-ethylbuta-1,3-dienyl]-N-ethylidenemethanimidamide
N'-[(1Z)-2-ethylbuta-1,3-dienyl]-N-ethylidenemethanimidamide (PubChem CID 155140053) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is N'-[(1Z)-2-ethylbuta-1,3-dienyl]-N-ethylidenemethanimidamide.
Molecular Properties
| Compound Name | N'-[(1Z)-2-ethylbuta-1,3-dienyl]-N-ethylidenemethanimidamide |
| PubChem CID | 155140053 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | N'-[(1Z)-2-ethylbuta-1,3-dienyl]-N-ethylidenemethanimidamide |
| SMILES | C=C/C(=C\N=C\N=C\C)CC |
| InChI | InChI=1S/C9H14N2/c1-4-9(5-2)7-11-8-10-6-3/h4,6-8H,1,5H2,2-3H3/b9-7+,10-6+,11-8+ |
| InChIKey | WTKJCALHQPFLMI-OFVXYYGZSA-N |
| XLogP | 2.59 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(1Z)-2-ethylbuta-1,3-dienyl]-N-ethylidenemethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(1Z)-2-ethylbuta-1,3-dienyl]-N-ethylidenemethanimidamide?
The IUPAC name of N'-[(1Z)-2-ethylbuta-1,3-dienyl]-N-ethylidenemethanimidamide (CID 155140053) is N'-[(1Z)-2-ethylbuta-1,3-dienyl]-N-ethylidenemethanimidamide.
What is the SMILES notation for N'-[(1Z)-2-ethylbuta-1,3-dienyl]-N-ethylidenemethanimidamide?
The canonical SMILES for N'-[(1Z)-2-ethylbuta-1,3-dienyl]-N-ethylidenemethanimidamide is C=C/C(=C\N=C\N=C\C)CC.
What is the InChIKey of N'-[(1Z)-2-ethylbuta-1,3-dienyl]-N-ethylidenemethanimidamide?
The InChIKey is WTKJCALHQPFLMI-OFVXYYGZSA-N. The full InChI is InChI=1S/C9H14N2/c1-4-9(5-2)7-11-8-10-6-3/h4,6-8H,1,5H2,2-3H3/b9-7+,10-6+,11-8+.
What are the key properties of N'-[(1Z)-2-ethylbuta-1,3-dienyl]-N-ethylidenemethanimidamide?
N'-[(1Z)-2-ethylbuta-1,3-dienyl]-N-ethylidenemethanimidamide has a molecular weight of 150.22 g/mol, XLogP of 2.59, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(1Z)-2-ethylbuta-1,3-dienyl]-N-ethylidenemethanimidamide is sourced from PubChem (CID 155140053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).