C35H47N5O4 — CID 155140207
(3S,6S)-6-(6-oxooctyl)-22-oxa-5,8,18,26,33-pentazahexacyclo[24.2.2.17,10.111,15.114,18.01,3]tritriaconta-7,9,11(32),12,14,16-hexaene-4,31-dione (PubChem CID 155140207) has the molecular formula C35H47N5O4 and a molecular weight of 601.79 g/mol. Its IUPAC name is (3S,6S)-6-(6-oxooctyl)-22-oxa-5,8,18,26,33-pentazahexacyclo[24.2.2.17,10.111,15.114,18.01,3]tritriaconta-7,9,11(32),12,14,16-hexaene-4,31-dione.
| Compound Name | (3S,6S)-6-(6-oxooctyl)-22-oxa-5,8,18,26,33-pentazahexacyclo[24.2.2.17,10.111,15.114,18.01,3]tritriaconta-7,9,11(32),12,14,16-hexaene-4,31-dione |
|---|---|
| PubChem CID | 155140207 |
| Molecular Formula | C35H47N5O4 |
| Molecular Weight | 601.79 g/mol |
| Exact Mass | 601.36 |
| IUPAC Name | (3S,6S)-6-(6-oxooctyl)-22-oxa-5,8,18,26,33-pentazahexacyclo[24.2.2.17,10.111,15.114,18.01,3]tritriaconta-7,9,11(32),12,14,16-hexaene-4,31-dione |
| SMILES | CCC(=O)CCCCC[C@@H]1NC(=O)[C@H]2CC23CCN(CCCOCCCn2ccc4cc(ccc4c2=O)-c2cnc1[nH]2)CC3 |
| InChI | InChI=1S/C35H47N5O4/c1-2-27(41)8-4-3-5-9-30-32-36-24-31(37-32)26-10-11-28-25(22-26)12-17-40(34(28)43)16-7-21-44-20-6-15-39-18-13-35(14-19-39)23-29(35)33(42)38-30/h10-12,17,22,24,29-30H,2-9,13-16,18-21,23H2,1H3,(H,36,37)(H,38,42)/t29-,30+/m1/s1 |
| InChIKey | PLWBVDLCWWJINE-IHLOFXLRSA-N |
| XLogP | 5.39 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.79 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|